C35H54O18 — CID 67645342
benzene-1,4-diol;2,2-bis(hydroxymethyl)propane-1,3-diol;hexakis(2-methylprop-2-enoic acid) (PubChem CID 67645342) has the molecular formula C35H54O18 and a molecular weight of 762.80 g/mol. Its IUPAC name is benzene-1,4-diol;2,2-bis(hydroxymethyl)propane-1,3-diol;hexakis(2-methylprop-2-enoic acid).
| Compound Name | benzene-1,4-diol;2,2-bis(hydroxymethyl)propane-1,3-diol;hexakis(2-methylprop-2-enoic acid) |
|---|---|
| PubChem CID | 67645342 |
| Molecular Formula | C35H54O18 |
| Molecular Weight | 762.80 g/mol |
| Exact Mass | 762.33 |
| IUPAC Name | benzene-1,4-diol;2,2-bis(hydroxymethyl)propane-1,3-diol;hexakis(2-methylprop-2-enoic acid) |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)O.C=C(C)C(=O)O.OCC(CO)(CO)CO.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C6H6O2.C5H12O4.6C4H6O2/c7-5-1-2-6(8)4-3-5;6-1-5(2-7,3-8)4-9;6*1-3(2)4(5)6/h1-4,7-8H;6-9H,1-4H2;6*1H2,2H3,(H,5,6) |
| InChIKey | ONVNACDYCDXJCX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 345.18 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.80 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|