C16H11F3O3 — CID 67745909
3,3,3-trifluoroprop-1-en-2-yl 4-(4-hydroxyphenyl)benzoate (PubChem CID 67745909) has the molecular formula C16H11F3O3 and a molecular weight of 308.26 g/mol. Its IUPAC name is 3,3,3-trifluoroprop-1-en-2-yl 4-(4-hydroxyphenyl)benzoate.
| Compound Name | 3,3,3-trifluoroprop-1-en-2-yl 4-(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 67745909 |
| Molecular Formula | C16H11F3O3 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 3,3,3-trifluoroprop-1-en-2-yl 4-(4-hydroxyphenyl)benzoate |
| SMILES | C=C(OC(=O)c1ccc(-c2ccc(O)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H11F3O3/c1-10(16(17,18)19)22-15(21)13-4-2-11(3-5-13)12-6-8-14(20)9-7-12/h2-9,20H,1H2 |
| InChIKey | YPKLORXYZHYCFZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|