C25H16F4N2O6 — CID 67943992
1-O-[2-fluoro-4-(5-prop-2-enoxycarbonylpyrimidin-2-yl)phenyl] 4-O-(3,3,3-trifluoroprop-1-en-2-yl) benzene-1,4-dicarboxylate (PubChem CID 67943992) has the molecular formula C25H16F4N2O6 and a molecular weight of 516.40 g/mol. Its IUPAC name is 1-O-[2-fluoro-4-(5-prop-2-enoxycarbonylpyrimidin-2-yl)phenyl] 4-O-(3,3,3-trifluoroprop-1-en-2-yl) benzene-1,4-dicarboxylate.
| Compound Name | 1-O-[2-fluoro-4-(5-prop-2-enoxycarbonylpyrimidin-2-yl)phenyl] 4-O-(3,3,3-trifluoroprop-1-en-2-yl) benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 67943992 |
| Molecular Formula | C25H16F4N2O6 |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | 1-O-[2-fluoro-4-(5-prop-2-enoxycarbonylpyrimidin-2-yl)phenyl] 4-O-(3,3,3-trifluoroprop-1-en-2-yl) benzene-1,4-dicarboxylate |
| SMILES | C=CCOC(=O)c1cnc(-c2ccc(OC(=O)c3ccc(C(=O)OC(=C)C(F)(F)F)cc3)c(F)c2)nc1 |
| InChI | InChI=1S/C25H16F4N2O6/c1-3-10-35-22(32)18-12-30-21(31-13-18)17-8-9-20(19(26)11-17)37-24(34)16-6-4-15(5-7-16)23(33)36-14(2)25(27,28)29/h3-9,11-13H,1-2,10H2 |
| InChIKey | WUXFWUAXGNIIBZ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|