C24H16F4N2O4 — CID 67943983
1-O-[4-(5-prop-2-enylpyrimidin-2-yl)phenyl] 4-O-(3,3,3-trifluoroprop-1-en-2-yl) 2-fluorobenzene-1,4-dicarboxylate (PubChem CID 67943983) has the molecular formula C24H16F4N2O4 and a molecular weight of 472.39 g/mol. Its IUPAC name is 1-O-[4-(5-prop-2-enylpyrimidin-2-yl)phenyl] 4-O-(3,3,3-trifluoroprop-1-en-2-yl) 2-fluorobenzene-1,4-dicarboxylate.
| Compound Name | 1-O-[4-(5-prop-2-enylpyrimidin-2-yl)phenyl] 4-O-(3,3,3-trifluoroprop-1-en-2-yl) 2-fluorobenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 67943983 |
| Molecular Formula | C24H16F4N2O4 |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 1-O-[4-(5-prop-2-enylpyrimidin-2-yl)phenyl] 4-O-(3,3,3-trifluoroprop-1-en-2-yl) 2-fluorobenzene-1,4-dicarboxylate |
| SMILES | C=CCc1cnc(-c2ccc(OC(=O)c3ccc(C(=O)OC(=C)C(F)(F)F)cc3F)cc2)nc1 |
| InChI | InChI=1S/C24H16F4N2O4/c1-3-4-15-12-29-21(30-13-15)16-5-8-18(9-6-16)34-23(32)19-10-7-17(11-20(19)25)22(31)33-14(2)24(26,27)28/h3,5-13H,1-2,4H2 |
| InChIKey | CVGIZXUJOGBZBB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|