C10H7F3O2 — CID 12032060
5-(3,3,3-trifluoroprop-1-en-2-yl)-1,3-benzodioxole (PubChem CID 12032060) has the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. Its IUPAC name is 5-(3,3,3-trifluoroprop-1-en-2-yl)-1,3-benzodioxole.
| Compound Name | 5-(3,3,3-trifluoroprop-1-en-2-yl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 12032060 |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 5-(3,3,3-trifluoroprop-1-en-2-yl)-1,3-benzodioxole |
| SMILES | C=C(c1ccc2c(c1)OCO2)C(F)(F)F |
| InChI | InChI=1S/C10H7F3O2/c1-6(10(11,12)13)7-2-3-8-9(4-7)15-5-14-8/h2-4H,1,5H2 |
| InChIKey | TYCMIUSHZQGJLD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |