About CID 59967604
CID 59967604 (PubChem CID 59967604) has the molecular formula C11H9F3NO3
and a molecular weight of 260.19 g/mol.
Molecular Properties
| Compound Name | CID 59967604 |
| PubChem CID | 59967604 |
| Molecular Formula | C11H9F3NO3 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | — |
| SMILES | [CH2]O/N=C(/c1ccc2c(c1)OCCO2)C(F)(F)F |
| InChI | InChI=1S/C11H9F3NO3/c1-16-15-10(11(12,13)14)7-2-3-8-9(6-7)18-5-4-17-8/h2-3,6H,1,4-5H2/b15-10- |
| InChIKey | YQRCBGCTEFSOJL-GDNBJRDFSA-N |
| XLogP | 2.53 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 59967604 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59967604?
The IUPAC name of CID 59967604 (CID 59967604) is not available.
What is the SMILES notation for CID 59967604?
The canonical SMILES for CID 59967604 is [CH2]O/N=C(/c1ccc2c(c1)OCCO2)C(F)(F)F.
What is the InChIKey of CID 59967604?
The InChIKey is YQRCBGCTEFSOJL-GDNBJRDFSA-N. The full InChI is InChI=1S/C11H9F3NO3/c1-16-15-10(11(12,13)14)7-2-3-8-9(6-7)18-5-4-17-8/h2-3,6H,1,4-5H2/b15-10-.
What are the key properties of CID 59967604?
CID 59967604 has a molecular weight of 260.19 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59967604 is sourced from PubChem (CID 59967604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).