C11H9F3NO3 — CID 59967604
CID 59967604 (PubChem CID 59967604) has the molecular formula C11H9F3NO3 and a molecular weight of 260.19 g/mol.
| Compound Name | CID 59967604 |
|---|---|
| PubChem CID | 59967604 |
| Molecular Formula | C11H9F3NO3 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | — |
| SMILES | [CH2]O/N=C(/c1ccc2c(c1)OCCO2)C(F)(F)F |
| InChI | InChI=1S/C11H9F3NO3/c1-16-15-10(11(12,13)14)7-2-3-8-9(6-7)18-5-4-17-8/h2-3,6H,1,4-5H2/b15-10- |
| InChIKey | YQRCBGCTEFSOJL-GDNBJRDFSA-N |
| XLogP | 2.53 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|