C9H6F3NO2 — CID 149036550
1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanimine (PubChem CID 149036550) has the molecular formula C9H6F3NO2 and a molecular weight of 217.15 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanimine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanimine |
|---|---|
| PubChem CID | 149036550 |
| Molecular Formula | C9H6F3NO2 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2,2,2-trifluoroethanimine |
| SMILES | [H]/N=C(\c1ccc2c(c1)OCO2)C(F)(F)F |
| InChI | InChI=1S/C9H6F3NO2/c10-9(11,12)8(13)5-1-2-6-7(3-5)15-4-14-6/h1-3,13H,4H2/b13-8+ |
| InChIKey | QGSVMMQFDJYNLT-MDWZMJQESA-N |
| XLogP | 2.35 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|