C12H11NO5 — CID 143383491
(E)-2-(1,3-benzodioxole-5-carboximidoyl)-3-hydroxybut-2-enoic acid (PubChem CID 143383491) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is (E)-2-(1,3-benzodioxole-5-carboximidoyl)-3-hydroxybut-2-enoic acid.
| Compound Name | (E)-2-(1,3-benzodioxole-5-carboximidoyl)-3-hydroxybut-2-enoic acid |
|---|---|
| PubChem CID | 143383491 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (E)-2-(1,3-benzodioxole-5-carboximidoyl)-3-hydroxybut-2-enoic acid |
| SMILES | [H]/N=C(C(\C(=O)O)=C(\C)O)/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H11NO5/c1-6(14)10(12(15)16)11(13)7-2-3-8-9(4-7)18-5-17-8/h2-4,13-14H,5H2,1H3,(H,15,16)/b10-6+,13-11- |
| InChIKey | ZHBLHAOBLUMDBG-MVEXZXKGSA-N |
| XLogP | 1.70 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|