C10H7F3O2 — CID 115029399
(E)-4,4,4-trifluoro-3-(4-hydroxyphenyl)but-2-enal (PubChem CID 115029399) has the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-3-(4-hydroxyphenyl)but-2-enal.
| Compound Name | (E)-4,4,4-trifluoro-3-(4-hydroxyphenyl)but-2-enal |
|---|---|
| PubChem CID | 115029399 |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (E)-4,4,4-trifluoro-3-(4-hydroxyphenyl)but-2-enal |
| SMILES | O=C/C=C(\c1ccc(O)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H7F3O2/c11-10(12,13)9(5-6-14)7-1-3-8(15)4-2-7/h1-6,15H/b9-5+ |
| InChIKey | LXVKHOZSKUWNBS-WEVVVXLNSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|