C13H11F3O3 — CID 89169596
(Z)-3-[3-(1,3-dioxolan-2-yl)phenyl]-4,4,4-trifluorobut-2-enal (PubChem CID 89169596) has the molecular formula C13H11F3O3 and a molecular weight of 272.22 g/mol. Its IUPAC name is (Z)-3-[3-(1,3-dioxolan-2-yl)phenyl]-4,4,4-trifluorobut-2-enal.
| Compound Name | (Z)-3-[3-(1,3-dioxolan-2-yl)phenyl]-4,4,4-trifluorobut-2-enal |
|---|---|
| PubChem CID | 89169596 |
| Molecular Formula | C13H11F3O3 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (Z)-3-[3-(1,3-dioxolan-2-yl)phenyl]-4,4,4-trifluorobut-2-enal |
| SMILES | O=C/C=C(/c1cccc(C2OCCO2)c1)C(F)(F)F |
| InChI | InChI=1S/C13H11F3O3/c14-13(15,16)11(4-5-17)9-2-1-3-10(8-9)12-18-6-7-19-12/h1-5,8,12H,6-7H2/b11-4- |
| InChIKey | KUOPWEXOBCXTHX-WCIBSUBMSA-N |
| XLogP | 2.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|