C18H12Cl2F3NO2 — CID 140660435
4-[(Z)-4-(3,5-dichlorophenyl)-5,5,5-trifluoro-2-oxopent-3-enyl]benzamide (PubChem CID 140660435) has the molecular formula C18H12Cl2F3NO2 and a molecular weight of 402.20 g/mol. Its IUPAC name is 4-[(Z)-4-(3,5-dichlorophenyl)-5,5,5-trifluoro-2-oxopent-3-enyl]benzamide.
| Compound Name | 4-[(Z)-4-(3,5-dichlorophenyl)-5,5,5-trifluoro-2-oxopent-3-enyl]benzamide |
|---|---|
| PubChem CID | 140660435 |
| Molecular Formula | C18H12Cl2F3NO2 |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 4-[(Z)-4-(3,5-dichlorophenyl)-5,5,5-trifluoro-2-oxopent-3-enyl]benzamide |
| SMILES | NC(=O)c1ccc(CC(=O)/C=C(/c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12Cl2F3NO2/c19-13-6-12(7-14(20)8-13)16(18(21,22)23)9-15(25)5-10-1-3-11(4-2-10)17(24)26/h1-4,6-9H,5H2,(H2,24,26)/b16-9- |
| InChIKey | GHQMTZXREDJISV-SXGWCWSVSA-N |
| XLogP | 4.85 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|