C11H11F3N2O2 — CID 62733184
4-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]benzamide (PubChem CID 62733184) has the molecular formula C11H11F3N2O2 and a molecular weight of 260.22 g/mol. Its IUPAC name is 4-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]benzamide.
| Compound Name | 4-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 62733184 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.22 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-[[methyl-(2,2,2-trifluoroacetyl)amino]methyl]benzamide |
| SMILES | CN(Cc1ccc(C(N)=O)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C11H11F3N2O2/c1-16(10(18)11(12,13)14)6-7-2-4-8(5-3-7)9(15)17/h2-5H,6H2,1H3,(H2,15,17) |
| InChIKey | FENRWUKGQRXWIW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |