C15H8Cl3F3OS — CID 118344758
5-[(Z)-1-(benzenesulfinyl)-3,3,3-trifluoroprop-1-en-2-yl]-1,2,3-trichlorobenzene (PubChem CID 118344758) has the molecular formula C15H8Cl3F3OS and a molecular weight of 399.65 g/mol. Its IUPAC name is 5-[(Z)-1-(benzenesulfinyl)-3,3,3-trifluoroprop-1-en-2-yl]-1,2,3-trichlorobenzene.
| Compound Name | 5-[(Z)-1-(benzenesulfinyl)-3,3,3-trifluoroprop-1-en-2-yl]-1,2,3-trichlorobenzene |
|---|---|
| PubChem CID | 118344758 |
| Molecular Formula | C15H8Cl3F3OS |
| Molecular Weight | 399.65 g/mol |
| Exact Mass | 397.93 |
| IUPAC Name | 5-[(Z)-1-(benzenesulfinyl)-3,3,3-trifluoroprop-1-en-2-yl]-1,2,3-trichlorobenzene |
| SMILES | O=S(/C=C(/c1cc(Cl)c(Cl)c(Cl)c1)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H8Cl3F3OS/c16-12-6-9(7-13(17)14(12)18)11(15(19,20)21)8-23(22)10-4-2-1-3-5-10/h1-8H/b11-8- |
| InChIKey | NSWGNLLJORFHGM-FLIBITNWSA-N |
| XLogP | 6.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|