C17H8Cl2F3NOS — CID 71042650
(Z)-1-(1,3-benzothiazol-2-yl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one (PubChem CID 71042650) has the molecular formula C17H8Cl2F3NOS and a molecular weight of 402.22 g/mol. Its IUPAC name is (Z)-1-(1,3-benzothiazol-2-yl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one.
| Compound Name | (Z)-1-(1,3-benzothiazol-2-yl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one |
|---|---|
| PubChem CID | 71042650 |
| Molecular Formula | C17H8Cl2F3NOS |
| Molecular Weight | 402.22 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | (Z)-1-(1,3-benzothiazol-2-yl)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-en-1-one |
| SMILES | O=C(/C=C(/c1cc(Cl)cc(Cl)c1)C(F)(F)F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H8Cl2F3NOS/c18-10-5-9(6-11(19)7-10)12(17(20,21)22)8-14(24)16-23-13-3-1-2-4-15(13)25-16/h1-8H/b12-8- |
| InChIKey | JWKIWKPZQNUYKK-WQLSENKSSA-N |
| XLogP | 6.43 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.22 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|