C17H13ClN2OS2 — CID 71570220
(E)-3-(1,3-benzothiazol-2-ylamino)-1-(4-chlorophenyl)-3-methylsulfanylprop-2-en-1-one (PubChem CID 71570220) has the molecular formula C17H13ClN2OS2 and a molecular weight of 360.89 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-ylamino)-1-(4-chlorophenyl)-3-methylsulfanylprop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzothiazol-2-ylamino)-1-(4-chlorophenyl)-3-methylsulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 71570220 |
| Molecular Formula | C17H13ClN2OS2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-ylamino)-1-(4-chlorophenyl)-3-methylsulfanylprop-2-en-1-one |
| SMILES | CS/C(=C/C(=O)c1ccc(Cl)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H13ClN2OS2/c1-22-16(10-14(21)11-6-8-12(18)9-7-11)20-17-19-13-4-2-3-5-15(13)23-17/h2-10H,1H3,(H,19,20)/b16-10+ |
| InChIKey | AZJOBSQFNYGKQD-MHWRWJLKSA-N |
| XLogP | 5.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|