C19H14Cl2F4O3 — CID 123619505
methyl 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enyl]-2-methoxybenzoate (PubChem CID 123619505) has the molecular formula C19H14Cl2F4O3 and a molecular weight of 437.22 g/mol. Its IUPAC name is methyl 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enyl]-2-methoxybenzoate.
| Compound Name | methyl 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 123619505 |
| Molecular Formula | C19H14Cl2F4O3 |
| Molecular Weight | 437.22 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | methyl 4-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1ccc(CC=C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C19H14Cl2F4O3/c1-27-16-7-10(3-5-12(16)18(26)28-2)4-6-13(19(23,24)25)11-8-14(20)17(22)15(21)9-11/h3,5-9H,4H2,1-2H3 |
| InChIKey | SXZLIBGVUNNYJA-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.22 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|