C24H26ClF3N4O6 — CID 142793888
methyl 4-[(tert-butylamino)-[[2-chloro-5-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoyl]carbamoyl]amino]-2-methoxybenzoate (PubChem CID 142793888) has the molecular formula C24H26ClF3N4O6 and a molecular weight of 558.94 g/mol. Its IUPAC name is methyl 4-[(tert-butylamino)-[[2-chloro-5-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoyl]carbamoyl]amino]-2-methoxybenzoate.
| Compound Name | methyl 4-[(tert-butylamino)-[[2-chloro-5-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoyl]carbamoyl]amino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 142793888 |
| Molecular Formula | C24H26ClF3N4O6 |
| Molecular Weight | 558.94 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | methyl 4-[(tert-butylamino)-[[2-chloro-5-[[(2,2,2-trifluoroacetyl)amino]methyl]benzoyl]carbamoyl]amino]-2-methoxybenzoate |
| SMILES | COC(=O)c1ccc(N(NC(C)(C)C)C(=O)NC(=O)c2cc(CNC(=O)C(F)(F)F)ccc2Cl)cc1OC |
| InChI | InChI=1S/C24H26ClF3N4O6/c1-23(2,3)31-32(14-7-8-15(20(34)38-5)18(11-14)37-4)22(36)30-19(33)16-10-13(6-9-17(16)25)12-29-21(35)24(26,27)28/h6-11,31H,12H2,1-5H3,(H,29,35)(H,30,33,36) |
| InChIKey | IBTICWYIIKEUDY-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.94 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|