methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate

C10H13NO2S — CID 133058387

IUPACmethyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate
SMILESCOC(=O)c1sc(N)c2c1CCCC2
InChIInChI=1S/C10H13NO2S/c1-13-10(12)8-6-4-2-3-5-7(6)9(11)14-8/h2-5,11H2,1H3
InChIKeyRWAUCTCZQWJGBD-UHFFFAOYSA-N
MW211.29 g/mol
LogP2.00
Rot. Bonds1

About methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate

methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate (PubChem CID 133058387) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate.

Molecular Properties

Compound Namemethyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate
PubChem CID133058387
Molecular FormulaC10H13NO2S
Molecular Weight211.29 g/mol
Exact Mass211.07
IUPAC Namemethyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate
SMILESCOC(=O)c1sc(N)c2c1CCCC2
InChIInChI=1S/C10H13NO2S/c1-13-10(12)8-6-4-2-3-5-7(6)9(11)14-8/h2-5,11H2,1H3
InChIKeyRWAUCTCZQWJGBD-UHFFFAOYSA-N
XLogP2.00
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.29
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate?
The IUPAC name of methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate (CID 133058387) is methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate.
What is the SMILES notation for methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate?
The canonical SMILES for methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate is COC(=O)c1sc(N)c2c1CCCC2.
What is the InChIKey of methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate?
The InChIKey is RWAUCTCZQWJGBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-13-10(12)8-6-4-2-3-5-7(6)9(11)14-8/h2-5,11H2,1H3.
What are the key properties of methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate?
methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate has a molecular weight of 211.29 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate is sourced from PubChem (CID 133058387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).