C9H7F3O5 — CID 133062247
dimethyl 5-(trifluoromethyl)furan-2,4-dicarboxylate (PubChem CID 133062247) has the molecular formula C9H7F3O5 and a molecular weight of 252.14 g/mol. Its IUPAC name is dimethyl 5-(trifluoromethyl)furan-2,4-dicarboxylate.
| Compound Name | dimethyl 5-(trifluoromethyl)furan-2,4-dicarboxylate |
|---|---|
| PubChem CID | 133062247 |
| Molecular Formula | C9H7F3O5 |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | dimethyl 5-(trifluoromethyl)furan-2,4-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)c(C(F)(F)F)o1 |
| InChI | InChI=1S/C9H7F3O5/c1-15-7(13)4-3-5(8(14)16-2)17-6(4)9(10,11)12/h3H,1-2H3 |
| InChIKey | QPWVTXLDRBJIET-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |