methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate

C9H4F6O4 — CID 14130494

IUPACmethyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate
SMILESCOC(=O)c1c(C(F)(F)F)oc(C(F)(F)F)cc1=O
InChIInChI=1S/C9H4F6O4/c1-18-7(17)5-3(16)2-4(8(10,11)12)19-6(5)9(13,14)15/h2H,1H3
InChIKeyORFVNUIUJSXIHQ-UHFFFAOYSA-N
MW290.12 g/mol
LogP2.46
Rot. Bonds1

About methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate

methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate (PubChem CID 14130494) has the molecular formula C9H4F6O4 and a molecular weight of 290.12 g/mol. Its IUPAC name is methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate.

Molecular Properties

Compound Namemethyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate
PubChem CID14130494
Molecular FormulaC9H4F6O4
Molecular Weight290.12 g/mol
Exact Mass290.00
IUPAC Namemethyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate
SMILESCOC(=O)c1c(C(F)(F)F)oc(C(F)(F)F)cc1=O
InChIInChI=1S/C9H4F6O4/c1-18-7(17)5-3(16)2-4(8(10,11)12)19-6(5)9(13,14)15/h2H,1H3
InChIKeyORFVNUIUJSXIHQ-UHFFFAOYSA-N
XLogP2.46
TPSA56.51 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.12
LogP ≤ 52.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate?
The IUPAC name of methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate (CID 14130494) is methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate.
What is the SMILES notation for methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate?
The canonical SMILES for methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate is COC(=O)c1c(C(F)(F)F)oc(C(F)(F)F)cc1=O.
What is the InChIKey of methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate?
The InChIKey is ORFVNUIUJSXIHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F6O4/c1-18-7(17)5-3(16)2-4(8(10,11)12)19-6(5)9(13,14)15/h2H,1H3.
What are the key properties of methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate?
methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate has a molecular weight of 290.12 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-oxo-2,6-bis(trifluoromethyl)pyran-3-carboxylate is sourced from PubChem (CID 14130494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).