About 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid
4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid (PubChem CID 141046316) has the molecular formula C13H12O5
and a molecular weight of 248.23 g/mol. Its IUPAC name is 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid.
Analyze 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid?
The IUPAC name of 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid (CID 141046316) is 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid.
What is the SMILES notation for 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid?
The canonical SMILES for 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid is COC(=O)c1cc(C)c(C)c2oc(C(=O)O)cc12.
What is the InChIKey of 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid?
The InChIKey is OTDCBJCUZSVWSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O5/c1-6-4-9(13(16)17-3)8-5-10(12(14)15)18-11(8)7(6)2/h4-5H,1-3H3,(H,14,15).
What are the key properties of 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid?
4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid has a molecular weight of 248.23 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycarbonyl-6,7-dimethyl-1-benzofuran-2-carboxylic acid is sourced from PubChem (CID 141046316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).