C24H25Cl2N3O3S — CID 58504877
(2R)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-N-benzyl-N-methyl-4-phenylbutanamide (PubChem CID 58504877) has the molecular formula C24H25Cl2N3O3S and a molecular weight of 506.46 g/mol. Its IUPAC name is (2R)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-N-benzyl-N-methyl-4-phenylbutanamide.
| Compound Name | (2R)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-N-benzyl-N-methyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 58504877 |
| Molecular Formula | C24H25Cl2N3O3S |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | (2R)-2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-N-benzyl-N-methyl-4-phenylbutanamide |
| SMILES | CN(Cc1ccccc1)C(=O)[C@@H](CCc1ccccc1)NS(=O)(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C24H25Cl2N3O3S/c1-29(16-18-10-6-3-7-11-18)24(30)22(13-12-17-8-4-2-5-9-17)28-33(31,32)19-14-20(25)23(27)21(26)15-19/h2-11,14-15,22,28H,12-13,16,27H2,1H3/t22-/m1/s1 |
| InChIKey | BFTZOBITPYYKQZ-JOCHJYFZSA-N |
| XLogP | 4.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|