C31H31ClN2O4S — CID 43889202
N,N-dibenzyl-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 43889202) has the molecular formula C31H31ClN2O4S and a molecular weight of 563.12 g/mol. Its IUPAC name is N,N-dibenzyl-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N,N-dibenzyl-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43889202 |
| Molecular Formula | C31H31ClN2O4S |
| Molecular Weight | 563.12 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | N,N-dibenzyl-2-[(3-chloro-4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)N(Cc2ccccc2)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C31H31ClN2O4S/c1-2-38-30-19-18-27(21-28(30)32)39(36,37)33-29(20-24-12-6-3-7-13-24)31(35)34(22-25-14-8-4-9-15-25)23-26-16-10-5-11-17-26/h3-19,21,29,33H,2,20,22-23H2,1H3 |
| InChIKey | VLMGYZRVAOXOOR-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.12 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |