C23H23Cl2N5O3S — CID 123799963
2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-N-benzyl-4-(2-cyanopyrrol-1-yl)pentanamide (PubChem CID 123799963) has the molecular formula C23H23Cl2N5O3S and a molecular weight of 520.44 g/mol. Its IUPAC name is 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-N-benzyl-4-(2-cyanopyrrol-1-yl)pentanamide.
| Compound Name | 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-N-benzyl-4-(2-cyanopyrrol-1-yl)pentanamide |
|---|---|
| PubChem CID | 123799963 |
| Molecular Formula | C23H23Cl2N5O3S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-N-benzyl-4-(2-cyanopyrrol-1-yl)pentanamide |
| SMILES | CC(CC(NS(=O)(=O)c1cc(Cl)c(N)c(Cl)c1)C(=O)NCc1ccccc1)n1cccc1C#N |
| InChI | InChI=1S/C23H23Cl2N5O3S/c1-15(30-9-5-8-17(30)13-26)10-21(23(31)28-14-16-6-3-2-4-7-16)29-34(32,33)18-11-19(24)22(27)20(25)12-18/h2-9,11-12,15,21,29H,10,14,27H2,1H3,(H,28,31) |
| InChIKey | RZXXCEZKERBDQE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|