C24H25Cl2N5O3S — CID 58509254
2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-4-(2-cyanopyrrol-1-yl)-N-methyl-N-[(1R)-1-phenylethyl]butanamide (PubChem CID 58509254) has the molecular formula C24H25Cl2N5O3S and a molecular weight of 534.47 g/mol. Its IUPAC name is 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-4-(2-cyanopyrrol-1-yl)-N-methyl-N-[(1R)-1-phenylethyl]butanamide.
| Compound Name | 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-4-(2-cyanopyrrol-1-yl)-N-methyl-N-[(1R)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 58509254 |
| Molecular Formula | C24H25Cl2N5O3S |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 2-[(4-amino-3,5-dichlorophenyl)sulfonylamino]-4-(2-cyanopyrrol-1-yl)-N-methyl-N-[(1R)-1-phenylethyl]butanamide |
| SMILES | C[C@H](c1ccccc1)N(C)C(=O)C(CCn1cccc1C#N)NS(=O)(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C24H25Cl2N5O3S/c1-16(17-7-4-3-5-8-17)30(2)24(32)22(10-12-31-11-6-9-18(31)15-27)29-35(33,34)19-13-20(25)23(28)21(26)14-19/h3-9,11,13-14,16,22,29H,10,12,28H2,1-2H3/t16-,22?/m1/s1 |
| InChIKey | XODPWYWOPXSXDN-XESZBRCGSA-N |
| XLogP | 4.21 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|