C18H20ClNO3S — CID 51946927
(2S)-N-benzyl-2-[(2-chlorophenyl)methylsulfonyl]-N-methylpropanamide (PubChem CID 51946927) has the molecular formula C18H20ClNO3S and a molecular weight of 365.88 g/mol. Its IUPAC name is (2S)-N-benzyl-2-[(2-chlorophenyl)methylsulfonyl]-N-methylpropanamide.
| Compound Name | (2S)-N-benzyl-2-[(2-chlorophenyl)methylsulfonyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 51946927 |
| Molecular Formula | C18H20ClNO3S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | (2S)-N-benzyl-2-[(2-chlorophenyl)methylsulfonyl]-N-methylpropanamide |
| SMILES | C[C@@H](C(=O)N(C)Cc1ccccc1)S(=O)(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C18H20ClNO3S/c1-14(18(21)20(2)12-15-8-4-3-5-9-15)24(22,23)13-16-10-6-7-11-17(16)19/h3-11,14H,12-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | PWCRRIHVRSQETQ-AWEZNQCLSA-N |
| XLogP | 3.30 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |