C18H21ClO4 — CID 886362
6-chloro-7-(3,3-dimethyl-2-oxobutoxy)-4-propylchromen-2-one (PubChem CID 886362) has the molecular formula C18H21ClO4 and a molecular weight of 336.82 g/mol. Its IUPAC name is 6-chloro-7-(3,3-dimethyl-2-oxobutoxy)-4-propylchromen-2-one.
| Compound Name | 6-chloro-7-(3,3-dimethyl-2-oxobutoxy)-4-propylchromen-2-one |
|---|---|
| PubChem CID | 886362 |
| Molecular Formula | C18H21ClO4 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 6-chloro-7-(3,3-dimethyl-2-oxobutoxy)-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2cc(OCC(=O)C(C)(C)C)c(Cl)cc12 |
| InChI | InChI=1S/C18H21ClO4/c1-5-6-11-7-17(21)23-14-9-15(13(19)8-12(11)14)22-10-16(20)18(2,3)4/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | FOOVIFOCGRNSQU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|