C16H24N4O2 — CID 87750186
(2S)-2-amino-N-hydroxy-4-(1-pentylbenzimidazol-2-yl)butanamide (PubChem CID 87750186) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2S)-2-amino-N-hydroxy-4-(1-pentylbenzimidazol-2-yl)butanamide.
| Compound Name | (2S)-2-amino-N-hydroxy-4-(1-pentylbenzimidazol-2-yl)butanamide |
|---|---|
| PubChem CID | 87750186 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (2S)-2-amino-N-hydroxy-4-(1-pentylbenzimidazol-2-yl)butanamide |
| SMILES | CCCCCn1c(CC[C@H](N)C(=O)NO)nc2ccccc21 |
| InChI | InChI=1S/C16H24N4O2/c1-2-3-6-11-20-14-8-5-4-7-13(14)18-15(20)10-9-12(17)16(21)19-22/h4-5,7-8,12,22H,2-3,6,9-11,17H2,1H3,(H,19,21)/t12-/m0/s1 |
| InChIKey | BBCBKLPLHGBNBD-LBPRGKRZSA-N |
| XLogP | 1.99 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|