C18H26N4O2 — CID 87751286
(2S)-2-amino-4-[1-(cyclohexylmethyl)benzimidazol-2-yl]-N-hydroxybutanamide (PubChem CID 87751286) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (2S)-2-amino-4-[1-(cyclohexylmethyl)benzimidazol-2-yl]-N-hydroxybutanamide.
| Compound Name | (2S)-2-amino-4-[1-(cyclohexylmethyl)benzimidazol-2-yl]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 87751286 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (2S)-2-amino-4-[1-(cyclohexylmethyl)benzimidazol-2-yl]-N-hydroxybutanamide |
| SMILES | N[C@@H](CCc1nc2ccccc2n1CC1CCCCC1)C(=O)NO |
| InChI | InChI=1S/C18H26N4O2/c19-14(18(23)21-24)10-11-17-20-15-8-4-5-9-16(15)22(17)12-13-6-2-1-3-7-13/h4-5,8-9,13-14,24H,1-3,6-7,10-12,19H2,(H,21,23)/t14-/m0/s1 |
| InChIKey | QCMPZVPZBYTCQJ-AWEZNQCLSA-N |
| XLogP | 2.38 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|