C21H32N4O2 — CID 23148274
2-(cyclohexylmethylamino)-N-hydroxy-4-(1-propylbenzimidazol-2-yl)butanamide (PubChem CID 23148274) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-(cyclohexylmethylamino)-N-hydroxy-4-(1-propylbenzimidazol-2-yl)butanamide.
| Compound Name | 2-(cyclohexylmethylamino)-N-hydroxy-4-(1-propylbenzimidazol-2-yl)butanamide |
|---|---|
| PubChem CID | 23148274 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 2-(cyclohexylmethylamino)-N-hydroxy-4-(1-propylbenzimidazol-2-yl)butanamide |
| SMILES | CCCn1c(CCC(NCC2CCCCC2)C(=O)NO)nc2ccccc21 |
| InChI | InChI=1S/C21H32N4O2/c1-2-14-25-19-11-7-6-10-17(19)23-20(25)13-12-18(21(26)24-27)22-15-16-8-4-3-5-9-16/h6-7,10-11,16,18,22,27H,2-5,8-9,12-15H2,1H3,(H,24,26) |
| InChIKey | FELYNDXDCAMDIB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|