C19H22N4O2 — CID 23148423
2-amino-N-hydroxy-4-[1-(2-phenylethyl)benzimidazol-2-yl]butanamide (PubChem CID 23148423) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-amino-N-hydroxy-4-[1-(2-phenylethyl)benzimidazol-2-yl]butanamide.
| Compound Name | 2-amino-N-hydroxy-4-[1-(2-phenylethyl)benzimidazol-2-yl]butanamide |
|---|---|
| PubChem CID | 23148423 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-amino-N-hydroxy-4-[1-(2-phenylethyl)benzimidazol-2-yl]butanamide |
| SMILES | NC(CCc1nc2ccccc2n1CCc1ccccc1)C(=O)NO |
| InChI | InChI=1S/C19H22N4O2/c20-15(19(24)22-25)10-11-18-21-16-8-4-5-9-17(16)23(18)13-12-14-6-2-1-3-7-14/h1-9,15,25H,10-13,20H2,(H,22,24) |
| InChIKey | IACJAHZCCYJWPO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|