C19H21ClN6O — CID 87328795
3,5-diamino-6-chloro-N-[[1-(cyclobutylmethyl)benzimidazol-2-yl]methyl]pyridine-2-carboxamide (PubChem CID 87328795) has the molecular formula C19H21ClN6O and a molecular weight of 384.87 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[[1-(cyclobutylmethyl)benzimidazol-2-yl]methyl]pyridine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[[1-(cyclobutylmethyl)benzimidazol-2-yl]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87328795 |
| Molecular Formula | C19H21ClN6O |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[[1-(cyclobutylmethyl)benzimidazol-2-yl]methyl]pyridine-2-carboxamide |
| SMILES | Nc1cc(N)c(C(=O)NCc2nc3ccccc3n2CC2CCC2)nc1Cl |
| InChI | InChI=1S/C19H21ClN6O/c20-18-13(22)8-12(21)17(25-18)19(27)23-9-16-24-14-6-1-2-7-15(14)26(16)10-11-4-3-5-11/h1-2,6-8,11H,3-5,9-10,21-22H2,(H,23,27) |
| InChIKey | VUZBYIKOUHSZNK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|