C21H23F2N3O6 — CID 150385913
benzyl N-acetyl-N-[4-amino-2,2-difluoro-3-hydroxy-5-(4-nitrophenyl)pentyl]carbamate (PubChem CID 150385913) has the molecular formula C21H23F2N3O6 and a molecular weight of 451.43 g/mol. Its IUPAC name is benzyl N-acetyl-N-[4-amino-2,2-difluoro-3-hydroxy-5-(4-nitrophenyl)pentyl]carbamate.
| Compound Name | benzyl N-acetyl-N-[4-amino-2,2-difluoro-3-hydroxy-5-(4-nitrophenyl)pentyl]carbamate |
|---|---|
| PubChem CID | 150385913 |
| Molecular Formula | C21H23F2N3O6 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | benzyl N-acetyl-N-[4-amino-2,2-difluoro-3-hydroxy-5-(4-nitrophenyl)pentyl]carbamate |
| SMILES | CC(=O)N(CC(F)(F)C(O)C(N)Cc1ccc([N+](=O)[O-])cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H23F2N3O6/c1-14(27)25(20(29)32-12-16-5-3-2-4-6-16)13-21(22,23)19(28)18(24)11-15-7-9-17(10-8-15)26(30)31/h2-10,18-19,28H,11-13,24H2,1H3 |
| InChIKey | HARTYMHQZGBWNN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 136.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|