C19H21F2N3O5 — CID 150577920
benzyl N-[4-amino-2,2-difluoro-3-hydroxy-5-(4-nitrophenyl)pentyl]carbamate (PubChem CID 150577920) has the molecular formula C19H21F2N3O5 and a molecular weight of 409.39 g/mol. Its IUPAC name is benzyl N-[4-amino-2,2-difluoro-3-hydroxy-5-(4-nitrophenyl)pentyl]carbamate.
| Compound Name | benzyl N-[4-amino-2,2-difluoro-3-hydroxy-5-(4-nitrophenyl)pentyl]carbamate |
|---|---|
| PubChem CID | 150577920 |
| Molecular Formula | C19H21F2N3O5 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | benzyl N-[4-amino-2,2-difluoro-3-hydroxy-5-(4-nitrophenyl)pentyl]carbamate |
| SMILES | NC(Cc1ccc([N+](=O)[O-])cc1)C(O)C(F)(F)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H21F2N3O5/c20-19(21,12-23-18(26)29-11-14-4-2-1-3-5-14)17(25)16(22)10-13-6-8-15(9-7-13)24(27)28/h1-9,16-17,25H,10-12,22H2,(H,23,26) |
| InChIKey | INFDMVZHFPSLHO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|