C24H21N3O — CID 126251312
(Z)-2-cyano-N-(3-phenylpropyl)-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide (PubChem CID 126251312) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-phenylpropyl)-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-phenylpropyl)-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126251312 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | (Z)-2-cyano-N-(3-phenylpropyl)-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide |
| SMILES | C#CCn1cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O/c1-2-15-27-18-21(22-12-6-7-13-23(22)27)16-20(17-25)24(28)26-14-8-11-19-9-4-3-5-10-19/h1,3-7,9-10,12-13,16,18H,8,11,14-15H2,(H,26,28)/b20-16- |
| InChIKey | NWRSRBIYXQFGFO-SILNSSARSA-N |
| XLogP | 3.93 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|