C21H14BrN3O — CID 2883347
N-(3-bromophenyl)-2-cyano-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide (PubChem CID 2883347) has the molecular formula C21H14BrN3O and a molecular weight of 404.27 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-cyano-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide.
| Compound Name | N-(3-bromophenyl)-2-cyano-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 2883347 |
| Molecular Formula | C21H14BrN3O |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | N-(3-bromophenyl)-2-cyano-3-(1-prop-2-ynylindol-3-yl)prop-2-enamide |
| SMILES | C#CCn1cc(C=C(C#N)C(=O)Nc2cccc(Br)c2)c2ccccc21 |
| InChI | InChI=1S/C21H14BrN3O/c1-2-10-25-14-16(19-8-3-4-9-20(19)25)11-15(13-23)21(26)24-18-7-5-6-17(22)12-18/h1,3-9,11-12,14H,10H2,(H,24,26) |
| InChIKey | KLOOAKYUQDEKRA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|