C19H14BrN3O — CID 1366456
(E)-N-(3-bromophenyl)-2-cyano-3-(1-methylindol-3-yl)prop-2-enamide (PubChem CID 1366456) has the molecular formula C19H14BrN3O and a molecular weight of 380.25 g/mol. Its IUPAC name is (E)-N-(3-bromophenyl)-2-cyano-3-(1-methylindol-3-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-bromophenyl)-2-cyano-3-(1-methylindol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1366456 |
| Molecular Formula | C19H14BrN3O |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | (E)-N-(3-bromophenyl)-2-cyano-3-(1-methylindol-3-yl)prop-2-enamide |
| SMILES | Cn1cc(/C=C(\C#N)C(=O)Nc2cccc(Br)c2)c2ccccc21 |
| InChI | InChI=1S/C19H14BrN3O/c1-23-12-14(17-7-2-3-8-18(17)23)9-13(11-21)19(24)22-16-6-4-5-15(20)10-16/h2-10,12H,1H3,(H,22,24)/b13-9+ |
| InChIKey | GXSHIERNBIPCKB-UKTHLTGXSA-N |
| XLogP | 4.49 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|