C27H38N4O2 — CID 71546502
(E)-2-cyano-3-[1-(2-hydroxy-3-pyrrolidin-1-ylpropyl)indol-3-yl]-N-octylprop-2-enamide (PubChem CID 71546502) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-(2-hydroxy-3-pyrrolidin-1-ylpropyl)indol-3-yl]-N-octylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-(2-hydroxy-3-pyrrolidin-1-ylpropyl)indol-3-yl]-N-octylprop-2-enamide |
|---|---|
| PubChem CID | 71546502 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (E)-2-cyano-3-[1-(2-hydroxy-3-pyrrolidin-1-ylpropyl)indol-3-yl]-N-octylprop-2-enamide |
| SMILES | CCCCCCCCNC(=O)/C(C#N)=C/c1cn(CC(O)CN2CCCC2)c2ccccc12 |
| InChI | InChI=1S/C27H38N4O2/c1-2-3-4-5-6-9-14-29-27(33)22(18-28)17-23-19-31(26-13-8-7-12-25(23)26)21-24(32)20-30-15-10-11-16-30/h7-8,12-13,17,19,24,32H,2-6,9-11,14-16,20-21H2,1H3,(H,29,33)/b22-17+ |
| InChIKey | CCGPJYWVFUVWCQ-OQKWZONESA-N |
| XLogP | 4.48 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|