C26H25N3O2 — CID 108838971
(Z)-3-(N-benzylanilino)-2-cyano-N-[2-(4-methoxyphenyl)ethyl]prop-2-enamide (PubChem CID 108838971) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is (Z)-3-(N-benzylanilino)-2-cyano-N-[2-(4-methoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-(N-benzylanilino)-2-cyano-N-[2-(4-methoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108838971 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (Z)-3-(N-benzylanilino)-2-cyano-N-[2-(4-methoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C\N(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H25N3O2/c1-31-25-14-12-21(13-15-25)16-17-28-26(30)23(18-27)20-29(24-10-6-3-7-11-24)19-22-8-4-2-5-9-22/h2-15,20H,16-17,19H2,1H3,(H,28,30)/b23-20- |
| InChIKey | ILWJGEQAOOOHKU-ATJXCDBQSA-N |
| XLogP | 4.47 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|