C23H34N4O — CID 108829998
(Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-benzyl-2-cyano-N-propan-2-ylprop-2-enamide (PubChem CID 108829998) has the molecular formula C23H34N4O and a molecular weight of 382.55 g/mol. Its IUPAC name is (Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-benzyl-2-cyano-N-propan-2-ylprop-2-enamide.
| Compound Name | (Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-benzyl-2-cyano-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 108829998 |
| Molecular Formula | C23H34N4O |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-N-benzyl-2-cyano-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)/C(C#N)=C\N1C(C)(C)CC(N)CC1(C)C |
| InChI | InChI=1S/C23H34N4O/c1-17(2)26(15-18-10-8-7-9-11-18)21(28)19(14-24)16-27-22(3,4)12-20(25)13-23(27,5)6/h7-11,16-17,20H,12-13,15,25H2,1-6H3/b19-16- |
| InChIKey | LLOGRSYKDNNTQC-MNDPQUGUSA-N |
| XLogP | 3.81 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|