C16H26N4O3 — CID 108817705
3-[[(Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyanoprop-2-enoyl]amino]propanoic acid (PubChem CID 108817705) has the molecular formula C16H26N4O3 and a molecular weight of 322.41 g/mol. Its IUPAC name is 3-[[(Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyanoprop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyanoprop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108817705 |
| Molecular Formula | C16H26N4O3 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 3-[[(Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyanoprop-2-enoyl]amino]propanoic acid |
| SMILES | CC1(C)CC(N)CC(C)(C)N1/C=C(/C#N)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C16H26N4O3/c1-15(2)7-12(18)8-16(3,4)20(15)10-11(9-17)14(23)19-6-5-13(21)22/h10,12H,5-8,18H2,1-4H3,(H,19,23)(H,21,22)/b11-10- |
| InChIKey | YLFMEMLBNCYTCS-KHPPLWFESA-N |
| XLogP | 0.97 |
| TPSA | 119.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|