C20H28N4O2 — CID 108843343
(Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyano-N-(4-hydroxy-2-methylphenyl)prop-2-enamide (PubChem CID 108843343) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyano-N-(4-hydroxy-2-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyano-N-(4-hydroxy-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108843343 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyano-N-(4-hydroxy-2-methylphenyl)prop-2-enamide |
| SMILES | Cc1cc(O)ccc1NC(=O)/C(C#N)=C\N1C(C)(C)CC(N)CC1(C)C |
| InChI | InChI=1S/C20H28N4O2/c1-13-8-16(25)6-7-17(13)23-18(26)14(11-21)12-24-19(2,3)9-15(22)10-20(24,4)5/h6-8,12,15,25H,9-10,22H2,1-5H3,(H,23,26)/b14-12- |
| InChIKey | FTPLKWRSIYKQTE-OWBHPGMISA-N |
| XLogP | 3.03 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|