C22H32N4O2 — CID 108847442
(Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyano-N-[1-(4-methoxyphenyl)ethyl]prop-2-enamide (PubChem CID 108847442) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is (Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyano-N-[1-(4-methoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyano-N-[1-(4-methoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108847442 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (Z)-3-(4-amino-2,2,6,6-tetramethylpiperidin-1-yl)-2-cyano-N-[1-(4-methoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(C(C)NC(=O)/C(C#N)=C\N2C(C)(C)CC(N)CC2(C)C)cc1 |
| InChI | InChI=1S/C22H32N4O2/c1-15(16-7-9-19(28-6)10-8-16)25-20(27)17(13-23)14-26-21(2,3)11-18(24)12-22(26,4)5/h7-10,14-15,18H,11-12,24H2,1-6H3,(H,25,27)/b17-14- |
| InChIKey | QIMQVNQZFVAEJK-VKAVYKQESA-N |
| XLogP | 3.26 |
| TPSA | 91.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|