C20H26N4O4 — CID 108847185
1-[(Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]piperidine-4-carboxamide (PubChem CID 108847185) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 1-[(Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]piperidine-4-carboxamide.
| Compound Name | 1-[(Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108847185 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[(Z)-2-cyano-3-[1-(3,4-dimethoxyphenyl)ethylamino]-3-oxoprop-1-enyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(C(C)NC(=O)/C(C#N)=C\N2CCC(C(N)=O)CC2)cc1OC |
| InChI | InChI=1S/C20H26N4O4/c1-13(15-4-5-17(27-2)18(10-15)28-3)23-20(26)16(11-21)12-24-8-6-14(7-9-24)19(22)25/h4-5,10,12-14H,6-9H2,1-3H3,(H2,22,25)(H,23,26)/b16-12- |
| InChIKey | YEWKWHFSAXRNEW-VBKFSLOCSA-N |
| XLogP | 1.49 |
| TPSA | 117.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|