C19H25N3O3 — CID 108847029
(Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-piperidin-1-ylprop-2-enamide (PubChem CID 108847029) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-piperidin-1-ylprop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-piperidin-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 108847029 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (Z)-2-cyano-N-[1-(3,4-dimethoxyphenyl)ethyl]-3-piperidin-1-ylprop-2-enamide |
| SMILES | COc1ccc(C(C)NC(=O)/C(C#N)=C\N2CCCCC2)cc1OC |
| InChI | InChI=1S/C19H25N3O3/c1-14(15-7-8-17(24-2)18(11-15)25-3)21-19(23)16(12-20)13-22-9-5-4-6-10-22/h7-8,11,13-14H,4-6,9-10H2,1-3H3,(H,21,23)/b16-13- |
| InChIKey | JKIXQJQMRZPZQU-SSZFMOIBSA-N |
| XLogP | 2.77 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|