C16H18N4O3 — CID 108832121
1-[(Z)-2-cyano-3-(pyridin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylic acid (PubChem CID 108832121) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-[(Z)-2-cyano-3-(pyridin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(Z)-2-cyano-3-(pyridin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 108832121 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 1-[(Z)-2-cyano-3-(pyridin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylic acid |
| SMILES | N#C/C(=C/NCc1cccnc1)C(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H18N4O3/c17-8-14(11-19-10-12-2-1-5-18-9-12)15(21)20-6-3-13(4-7-20)16(22)23/h1-2,5,9,11,13,19H,3-4,6-7,10H2,(H,22,23)/b14-11- |
| InChIKey | SLDDMGIGLNQEAR-KAMYIIQDSA-N |
| XLogP | 0.90 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|