C10H8N4 — CID 17199659
2-[(pyridin-3-ylmethylamino)methylidene]propanedinitrile (PubChem CID 17199659) has the molecular formula C10H8N4 and a molecular weight of 184.20 g/mol. Its IUPAC name is 2-[(pyridin-3-ylmethylamino)methylidene]propanedinitrile.
| Compound Name | 2-[(pyridin-3-ylmethylamino)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 17199659 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-[(pyridin-3-ylmethylamino)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNCc1cccnc1 |
| InChI | InChI=1S/C10H8N4/c11-4-10(5-12)8-14-7-9-2-1-3-13-6-9/h1-3,6,8,14H,7H2 |
| InChIKey | VBIADIMRXBEREO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|