C19H21N3O5 — CID 108832362
1-[(Z)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylic acid (PubChem CID 108832362) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is 1-[(Z)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(Z)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 108832362 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 1-[(Z)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylic acid |
| SMILES | N#C/C(=C/NCC1COc2ccccc2O1)C(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C19H21N3O5/c20-9-14(18(23)22-7-5-13(6-8-22)19(24)25)10-21-11-15-12-26-16-3-1-2-4-17(16)27-15/h1-4,10,13,15,21H,5-8,11-12H2,(H,24,25)/b14-10- |
| InChIKey | IVDBAVPXUCUQAG-UVTDQMKNSA-N |
| XLogP | 1.15 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|