C19H15Cl2N3O3 — CID 108825296
(Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enamide (PubChem CID 108825296) has the molecular formula C19H15Cl2N3O3 and a molecular weight of 404.25 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108825296 |
| Molecular Formula | C19H15Cl2N3O3 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enamide |
| SMILES | N#C/C(=C/NCC1COc2ccccc2O1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H15Cl2N3O3/c20-14-4-3-5-15(18(14)21)24-19(25)12(8-22)9-23-10-13-11-26-16-6-1-2-7-17(16)27-13/h1-7,9,13,23H,10-11H2,(H,24,25)/b12-9- |
| InChIKey | BGCOZQODKIAUFB-XFXZXTDPSA-N |
| XLogP | 3.77 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|