C13H12Cl3N3O — CID 108825100
(Z)-3-(3-chloropropylamino)-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide (PubChem CID 108825100) has the molecular formula C13H12Cl3N3O and a molecular weight of 332.62 g/mol. Its IUPAC name is (Z)-3-(3-chloropropylamino)-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-(3-chloropropylamino)-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108825100 |
| Molecular Formula | C13H12Cl3N3O |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | (Z)-3-(3-chloropropylamino)-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/NCCCCl)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl3N3O/c14-5-2-6-18-8-9(7-17)13(20)19-11-4-1-3-10(15)12(11)16/h1,3-4,8,18H,2,5-6H2,(H,19,20)/b9-8- |
| InChIKey | QQJSGZBQBDJCRK-HJWRWDBZSA-N |
| XLogP | 3.56 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|